C12H20F2O — CID 154686336
(4,5-difluoro-2-methylphenyl)methanol;ethane (PubChem CID 154686336) has the molecular formula C12H20F2O and a molecular weight of 218.29 g/mol. Its IUPAC name is (4,5-difluoro-2-methylphenyl)methanol;ethane.
| Compound Name | (4,5-difluoro-2-methylphenyl)methanol;ethane |
|---|---|
| PubChem CID | 154686336 |
| Molecular Formula | C12H20F2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (4,5-difluoro-2-methylphenyl)methanol;ethane |
| SMILES | CC.CC.Cc1cc(F)c(F)cc1CO |
| InChI | InChI=1S/C8H8F2O.2C2H6/c1-5-2-7(9)8(10)3-6(5)4-11;2*1-2/h2-3,11H,4H2,1H3;2*1-2H3 |
| InChIKey | GMBOMEGVQXIMOY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |