C9H10BrFO — CID 84696348
(2-bromo-3-fluoro-5,6-dimethylphenyl)methanol (PubChem CID 84696348) has the molecular formula C9H10BrFO and a molecular weight of 233.08 g/mol. Its IUPAC name is (2-bromo-3-fluoro-5,6-dimethylphenyl)methanol.
| Compound Name | (2-bromo-3-fluoro-5,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 84696348 |
| Molecular Formula | C9H10BrFO |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | (2-bromo-3-fluoro-5,6-dimethylphenyl)methanol |
| SMILES | Cc1cc(F)c(Br)c(CO)c1C |
| InChI | InChI=1S/C9H10BrFO/c1-5-3-8(11)9(10)7(4-12)6(5)2/h3,12H,4H2,1-2H3 |
| InChIKey | WAUUKZCZMNTTDU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |