C10H13BrFNO — CID 117409447
1-(2-bromo-3-fluoro-5,6-dimethylphenyl)-N-methoxymethanamine (PubChem CID 117409447) has the molecular formula C10H13BrFNO and a molecular weight of 262.12 g/mol. Its IUPAC name is 1-(2-bromo-3-fluoro-5,6-dimethylphenyl)-N-methoxymethanamine.
| Compound Name | 1-(2-bromo-3-fluoro-5,6-dimethylphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117409447 |
| Molecular Formula | C10H13BrFNO |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 1-(2-bromo-3-fluoro-5,6-dimethylphenyl)-N-methoxymethanamine |
| SMILES | CONCc1c(C)c(C)cc(F)c1Br |
| InChI | InChI=1S/C10H13BrFNO/c1-6-4-9(12)10(11)8(7(6)2)5-13-14-3/h4,13H,5H2,1-3H3 |
| InChIKey | SPRISIQWHYYNPR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|