C10H14ClNO — CID 117288952
1-(6-chloro-2,3-dimethylphenyl)-N-methoxymethanamine (PubChem CID 117288952) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dimethylphenyl)-N-methoxymethanamine.
| Compound Name | 1-(6-chloro-2,3-dimethylphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117288952 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(6-chloro-2,3-dimethylphenyl)-N-methoxymethanamine |
| SMILES | CONCc1c(Cl)ccc(C)c1C |
| InChI | InChI=1S/C10H14ClNO/c1-7-4-5-10(11)9(8(7)2)6-12-13-3/h4-5,12H,6H2,1-3H3 |
| InChIKey | QBXZIERPPPNVOM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|