About 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol
1-(6-chloro-2,3-dimethylphenyl)propan-2-ol (PubChem CID 117288115) has the molecular formula C11H15ClO
and a molecular weight of 198.69 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol |
| PubChem CID | 117288115 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol |
| SMILES | Cc1ccc(Cl)c(CC(C)O)c1C |
| InChI | InChI=1S/C11H15ClO/c1-7-4-5-11(12)10(9(7)3)6-8(2)13/h4-5,8,13H,6H2,1-3H3 |
| InChIKey | PHNZKQDYZXZQRI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol?
The IUPAC name of 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol (CID 117288115) is 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol.
What is the SMILES notation for 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol?
The canonical SMILES for 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol is Cc1ccc(Cl)c(CC(C)O)c1C.
What is the InChIKey of 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol?
The InChIKey is PHNZKQDYZXZQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO/c1-7-4-5-11(12)10(9(7)3)6-8(2)13/h4-5,8,13H,6H2,1-3H3.
What are the key properties of 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol?
1-(6-chloro-2,3-dimethylphenyl)propan-2-ol has a molecular weight of 198.69 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-2,3-dimethylphenyl)propan-2-ol is sourced from PubChem (CID 117288115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).