About 3-(2-hydroxypropyl)-2,6-dimethylphenol
3-(2-hydroxypropyl)-2,6-dimethylphenol (PubChem CID 117278413) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(2-hydroxypropyl)-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 3-(2-hydroxypropyl)-2,6-dimethylphenol |
| PubChem CID | 117278413 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3-(2-hydroxypropyl)-2,6-dimethylphenol |
| SMILES | Cc1ccc(CC(C)O)c(C)c1O |
| InChI | InChI=1S/C11H16O2/c1-7-4-5-10(6-8(2)12)9(3)11(7)13/h4-5,8,12-13H,6H2,1-3H3 |
| InChIKey | UVWHHVXMCNCHDI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-hydroxypropyl)-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxypropyl)-2,6-dimethylphenol?
The IUPAC name of 3-(2-hydroxypropyl)-2,6-dimethylphenol (CID 117278413) is 3-(2-hydroxypropyl)-2,6-dimethylphenol.
What is the SMILES notation for 3-(2-hydroxypropyl)-2,6-dimethylphenol?
The canonical SMILES for 3-(2-hydroxypropyl)-2,6-dimethylphenol is Cc1ccc(CC(C)O)c(C)c1O.
What is the InChIKey of 3-(2-hydroxypropyl)-2,6-dimethylphenol?
The InChIKey is UVWHHVXMCNCHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-7-4-5-10(6-8(2)12)9(3)11(7)13/h4-5,8,12-13H,6H2,1-3H3.
What are the key properties of 3-(2-hydroxypropyl)-2,6-dimethylphenol?
3-(2-hydroxypropyl)-2,6-dimethylphenol has a molecular weight of 180.25 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxypropyl)-2,6-dimethylphenol is sourced from PubChem (CID 117278413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).