C10H15NO2 — CID 117278817
3-(2-aminooxyethyl)-2,6-dimethylphenol (PubChem CID 117278817) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-(2-aminooxyethyl)-2,6-dimethylphenol.
| Compound Name | 3-(2-aminooxyethyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 117278817 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-(2-aminooxyethyl)-2,6-dimethylphenol |
| SMILES | Cc1ccc(CCON)c(C)c1O |
| InChI | InChI=1S/C10H15NO2/c1-7-3-4-9(5-6-13-11)8(2)10(7)12/h3-4,12H,5-6,11H2,1-2H3 |
| InChIKey | DJFVZELEBQWRQC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|