C10H15NO2 — CID 117278812
4-(2-aminooxyethyl)-2,3-dimethylphenol (PubChem CID 117278812) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 4-(2-aminooxyethyl)-2,3-dimethylphenol.
| Compound Name | 4-(2-aminooxyethyl)-2,3-dimethylphenol |
|---|---|
| PubChem CID | 117278812 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4-(2-aminooxyethyl)-2,3-dimethylphenol |
| SMILES | Cc1c(O)ccc(CCON)c1C |
| InChI | InChI=1S/C10H15NO2/c1-7-8(2)10(12)4-3-9(7)5-6-13-11/h3-4,12H,5-6,11H2,1-2H3 |
| InChIKey | BVCCKWKAXWIPRK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|