C10H13BrO — CID 171479549
4-(2-bromoethyl)-2,3-dimethylphenol (PubChem CID 171479549) has the molecular formula C10H13BrO and a molecular weight of 229.12 g/mol. Its IUPAC name is 4-(2-bromoethyl)-2,3-dimethylphenol.
| Compound Name | 4-(2-bromoethyl)-2,3-dimethylphenol |
|---|---|
| PubChem CID | 171479549 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 4-(2-bromoethyl)-2,3-dimethylphenol |
| SMILES | Cc1c(O)ccc(CCBr)c1C |
| InChI | InChI=1S/C10H13BrO/c1-7-8(2)10(12)4-3-9(7)5-6-11/h3-4,12H,5-6H2,1-2H3 |
| InChIKey | RJZALQJVIMVJJL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|