C13H19Br — CID 163871132
1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene (PubChem CID 163871132) has the molecular formula C13H19Br and a molecular weight of 255.20 g/mol. Its IUPAC name is 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene.
| Compound Name | 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 163871132 |
| Molecular Formula | C13H19Br |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene |
| SMILES | CCc1cc(CCBr)c(C)c(C)c1C |
| InChI | InChI=1S/C13H19Br/c1-5-12-8-13(6-7-14)11(4)9(2)10(12)3/h8H,5-7H2,1-4H3 |
| InChIKey | PKWSNLRJHKDXLC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|