About 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene
1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene (PubChem CID 163871132) has the molecular formula C13H19Br
and a molecular weight of 255.20 g/mol. Its IUPAC name is 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene |
| PubChem CID | 163871132 |
| Molecular Formula | C13H19Br |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene |
| SMILES | CCc1cc(CCBr)c(C)c(C)c1C |
| InChI | InChI=1S/C13H19Br/c1-5-12-8-13(6-7-14)11(4)9(2)10(12)3/h8H,5-7H2,1-4H3 |
| InChIKey | PKWSNLRJHKDXLC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene?
The IUPAC name of 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene (CID 163871132) is 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene.
What is the SMILES notation for 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene?
The canonical SMILES for 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene is CCc1cc(CCBr)c(C)c(C)c1C.
What is the InChIKey of 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene?
The InChIKey is PKWSNLRJHKDXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Br/c1-5-12-8-13(6-7-14)11(4)9(2)10(12)3/h8H,5-7H2,1-4H3.
What are the key properties of 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene?
1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene has a molecular weight of 255.20 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromoethyl)-5-ethyl-2,3,4-trimethylbenzene is sourced from PubChem (CID 163871132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).