C11H14Br2 — CID 54559058
1,2-bis(2-bromoethyl)-4-methylbenzene (PubChem CID 54559058) has the molecular formula C11H14Br2 and a molecular weight of 306.04 g/mol. Its IUPAC name is 1,2-bis(2-bromoethyl)-4-methylbenzene.
| Compound Name | 1,2-bis(2-bromoethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 54559058 |
| Molecular Formula | C11H14Br2 |
| Molecular Weight | 306.04 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 1,2-bis(2-bromoethyl)-4-methylbenzene |
| SMILES | Cc1ccc(CCBr)c(CCBr)c1 |
| InChI | InChI=1S/C11H14Br2/c1-9-2-3-10(4-6-12)11(8-9)5-7-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | ZPFXAZLWDJINOR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.04 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|