C12H17I — CID 175748743
1,5-diethyl-3-iodo-2,4-dimethylbenzene (PubChem CID 175748743) has the molecular formula C12H17I and a molecular weight of 288.17 g/mol. Its IUPAC name is 1,5-diethyl-3-iodo-2,4-dimethylbenzene.
| Compound Name | 1,5-diethyl-3-iodo-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 175748743 |
| Molecular Formula | C12H17I |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,5-diethyl-3-iodo-2,4-dimethylbenzene |
| SMILES | CCc1cc(CC)c(C)c(I)c1C |
| InChI | InChI=1S/C12H17I/c1-5-10-7-11(6-2)9(4)12(13)8(10)3/h7H,5-6H2,1-4H3 |
| InChIKey | WYERNOJLFAYUQW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|