About 1,5-diethyl-3-iodo-2,4-dimethylbenzene
1,5-diethyl-3-iodo-2,4-dimethylbenzene (PubChem CID 175748743) has the molecular formula C12H17I
and a molecular weight of 288.17 g/mol. Its IUPAC name is 1,5-diethyl-3-iodo-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1,5-diethyl-3-iodo-2,4-dimethylbenzene |
| PubChem CID | 175748743 |
| Molecular Formula | C12H17I |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,5-diethyl-3-iodo-2,4-dimethylbenzene |
| SMILES | CCc1cc(CC)c(C)c(I)c1C |
| InChI | InChI=1S/C12H17I/c1-5-10-7-11(6-2)9(4)12(13)8(10)3/h7H,5-6H2,1-4H3 |
| InChIKey | WYERNOJLFAYUQW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,5-diethyl-3-iodo-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diethyl-3-iodo-2,4-dimethylbenzene?
The IUPAC name of 1,5-diethyl-3-iodo-2,4-dimethylbenzene (CID 175748743) is 1,5-diethyl-3-iodo-2,4-dimethylbenzene.
What is the SMILES notation for 1,5-diethyl-3-iodo-2,4-dimethylbenzene?
The canonical SMILES for 1,5-diethyl-3-iodo-2,4-dimethylbenzene is CCc1cc(CC)c(C)c(I)c1C.
What is the InChIKey of 1,5-diethyl-3-iodo-2,4-dimethylbenzene?
The InChIKey is WYERNOJLFAYUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17I/c1-5-10-7-11(6-2)9(4)12(13)8(10)3/h7H,5-6H2,1-4H3.
What are the key properties of 1,5-diethyl-3-iodo-2,4-dimethylbenzene?
1,5-diethyl-3-iodo-2,4-dimethylbenzene has a molecular weight of 288.17 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diethyl-3-iodo-2,4-dimethylbenzene is sourced from PubChem (CID 175748743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).