C11H19N3 — CID 70657615
[4,5-bis(aminomethyl)-2-ethylphenyl]methanamine (PubChem CID 70657615) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine.
| Compound Name | [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine |
|---|---|
| PubChem CID | 70657615 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine |
| SMILES | CCc1cc(CN)c(CN)cc1CN |
| InChI | InChI=1S/C11H19N3/c1-2-8-3-10(6-13)11(7-14)4-9(8)5-12/h3-4H,2,5-7,12-14H2,1H3 |
| InChIKey | DRWIPXAYUSRFGB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |