About [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine
[4,5-bis(aminomethyl)-2-ethylphenyl]methanamine (PubChem CID 70657615) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine.
Molecular Properties
| Compound Name | [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine |
| PubChem CID | 70657615 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine |
| SMILES | CCc1cc(CN)c(CN)cc1CN |
| InChI | InChI=1S/C11H19N3/c1-2-8-3-10(6-13)11(7-14)4-9(8)5-12/h3-4H,2,5-7,12-14H2,1H3 |
| InChIKey | DRWIPXAYUSRFGB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine?
The IUPAC name of [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine (CID 70657615) is [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine.
What is the SMILES notation for [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine?
The canonical SMILES for [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine is CCc1cc(CN)c(CN)cc1CN.
What is the InChIKey of [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine?
The InChIKey is DRWIPXAYUSRFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-2-8-3-10(6-13)11(7-14)4-9(8)5-12/h3-4H,2,5-7,12-14H2,1H3.
What are the key properties of [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine?
[4,5-bis(aminomethyl)-2-ethylphenyl]methanamine has a molecular weight of 193.29 g/mol, XLogP of 0.63, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-bis(aminomethyl)-2-ethylphenyl]methanamine is sourced from PubChem (CID 70657615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).