C11H16BrN — CID 58266734
(4-bromo-2,6-diethylphenyl)methanamine (PubChem CID 58266734) has the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. Its IUPAC name is (4-bromo-2,6-diethylphenyl)methanamine.
| Compound Name | (4-bromo-2,6-diethylphenyl)methanamine |
|---|---|
| PubChem CID | 58266734 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (4-bromo-2,6-diethylphenyl)methanamine |
| SMILES | CCc1cc(Br)cc(CC)c1CN |
| InChI | InChI=1S/C11H16BrN/c1-3-8-5-10(12)6-9(4-2)11(8)7-13/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | GOBQXMMCSXITNA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |