C9H12BrNO2 — CID 130139852
(4-bromo-2,6-dimethoxyphenyl)methanamine (PubChem CID 130139852) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is (4-bromo-2,6-dimethoxyphenyl)methanamine.
| Compound Name | (4-bromo-2,6-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 130139852 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | (4-bromo-2,6-dimethoxyphenyl)methanamine |
| SMILES | COc1cc(Br)cc(OC)c1CN |
| InChI | InChI=1S/C9H12BrNO2/c1-12-8-3-6(10)4-9(13-2)7(8)5-11/h3-4H,5,11H2,1-2H3 |
| InChIKey | WQVZDOGNUNPCGN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |