C10H15NO2 — CID 58024962
(2,6-dimethoxy-4-methylphenyl)methanamine (PubChem CID 58024962) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl)methanamine.
| Compound Name | (2,6-dimethoxy-4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 58024962 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2,6-dimethoxy-4-methylphenyl)methanamine |
| SMILES | COc1cc(C)cc(OC)c1CN |
| InChI | InChI=1S/C10H15NO2/c1-7-4-9(12-2)8(6-11)10(5-7)13-3/h4-5H,6,11H2,1-3H3 |
| InChIKey | XABCFCRJXKIIHM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |