C14H22O2 — CID 59743812
2-(2,2-dimethylpropyl)-1,3-dimethoxy-5-methylbenzene (PubChem CID 59743812) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-1,3-dimethoxy-5-methylbenzene.
| Compound Name | 2-(2,2-dimethylpropyl)-1,3-dimethoxy-5-methylbenzene |
|---|---|
| PubChem CID | 59743812 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-1,3-dimethoxy-5-methylbenzene |
| SMILES | COc1cc(C)cc(OC)c1CC(C)(C)C |
| InChI | InChI=1S/C14H22O2/c1-10-7-12(15-5)11(9-14(2,3)4)13(8-10)16-6/h7-8H,9H2,1-6H3 |
| InChIKey | IZJPJWOZWLTFIM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |