C14H24O — CID 170973865
2-ethyl-1-methoxy-3,5-dimethylbenzene;propane (PubChem CID 170973865) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 2-ethyl-1-methoxy-3,5-dimethylbenzene;propane.
| Compound Name | 2-ethyl-1-methoxy-3,5-dimethylbenzene;propane |
|---|---|
| PubChem CID | 170973865 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-ethyl-1-methoxy-3,5-dimethylbenzene;propane |
| SMILES | CCC.CCc1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C11H16O.C3H8/c1-5-10-9(3)6-8(2)7-11(10)12-4;1-3-2/h6-7H,5H2,1-4H3;3H2,1-2H3 |
| InChIKey | MNACUVWZMUELIC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |