C12H16N2O — CID 117043386
(2-methoxy-4,6-dimethylphenyl)methyl-methylcyanamide (PubChem CID 117043386) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (2-methoxy-4,6-dimethylphenyl)methyl-methylcyanamide.
| Compound Name | (2-methoxy-4,6-dimethylphenyl)methyl-methylcyanamide |
|---|---|
| PubChem CID | 117043386 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (2-methoxy-4,6-dimethylphenyl)methyl-methylcyanamide |
| SMILES | COc1cc(C)cc(C)c1CN(C)C#N |
| InChI | InChI=1S/C12H16N2O/c1-9-5-10(2)11(7-14(3)8-13)12(6-9)15-4/h5-6H,7H2,1-4H3 |
| InChIKey | ZHPJKLHYEFQLFI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|