C10H10F2N2O — CID 117043406
(2,5-difluoro-4-methoxyphenyl)methyl-methylcyanamide (PubChem CID 117043406) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is (2,5-difluoro-4-methoxyphenyl)methyl-methylcyanamide.
| Compound Name | (2,5-difluoro-4-methoxyphenyl)methyl-methylcyanamide |
|---|---|
| PubChem CID | 117043406 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2,5-difluoro-4-methoxyphenyl)methyl-methylcyanamide |
| SMILES | COc1cc(F)c(CN(C)C#N)cc1F |
| InChI | InChI=1S/C10H10F2N2O/c1-14(6-13)5-7-3-9(12)10(15-2)4-8(7)11/h3-4H,5H2,1-2H3 |
| InChIKey | NGTCFMCAJONDSW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|