C8H10F2N2O — CID 116932362
(2,5-difluoro-4-methoxyphenyl)methylhydrazine (PubChem CID 116932362) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is (2,5-difluoro-4-methoxyphenyl)methylhydrazine.
| Compound Name | (2,5-difluoro-4-methoxyphenyl)methylhydrazine |
|---|---|
| PubChem CID | 116932362 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (2,5-difluoro-4-methoxyphenyl)methylhydrazine |
| SMILES | COc1cc(F)c(CNN)cc1F |
| InChI | InChI=1S/C8H10F2N2O/c1-13-8-3-6(9)5(4-12-11)2-7(8)10/h2-3,12H,4,11H2,1H3 |
| InChIKey | NYZWMTRQNWAHQN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|