C10H13F2N3O2 — CID 115192963
1-amino-3-[2-(2,5-difluoro-4-methoxyphenyl)ethyl]urea (PubChem CID 115192963) has the molecular formula C10H13F2N3O2 and a molecular weight of 245.23 g/mol. Its IUPAC name is 1-amino-3-[2-(2,5-difluoro-4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-amino-3-[2-(2,5-difluoro-4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 115192963 |
| Molecular Formula | C10H13F2N3O2 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-amino-3-[2-(2,5-difluoro-4-methoxyphenyl)ethyl]urea |
| SMILES | COc1cc(F)c(CCNC(=O)NN)cc1F |
| InChI | InChI=1S/C10H13F2N3O2/c1-17-9-5-7(11)6(4-8(9)12)2-3-14-10(16)15-13/h4-5H,2-3,13H2,1H3,(H2,14,15,16) |
| InChIKey | STCAWXUBAVEMGM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|