C11H13F2NO2 — CID 115223282
2-[2-(2,5-difluoro-4-methoxyphenyl)ethylamino]acetaldehyde (PubChem CID 115223282) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-[2-(2,5-difluoro-4-methoxyphenyl)ethylamino]acetaldehyde.
| Compound Name | 2-[2-(2,5-difluoro-4-methoxyphenyl)ethylamino]acetaldehyde |
|---|---|
| PubChem CID | 115223282 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[2-(2,5-difluoro-4-methoxyphenyl)ethylamino]acetaldehyde |
| SMILES | COc1cc(F)c(CCNCC=O)cc1F |
| InChI | InChI=1S/C11H13F2NO2/c1-16-11-7-9(12)8(6-10(11)13)2-3-14-4-5-15/h5-7,14H,2-4H2,1H3 |
| InChIKey | YJFHUSOMZPJBQB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|