C10H12FNO3 — CID 171538109
N-[(5-fluoro-2,4-dimethoxyphenyl)methyl]formamide (PubChem CID 171538109) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is N-[(5-fluoro-2,4-dimethoxyphenyl)methyl]formamide.
| Compound Name | N-[(5-fluoro-2,4-dimethoxyphenyl)methyl]formamide |
|---|---|
| PubChem CID | 171538109 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-[(5-fluoro-2,4-dimethoxyphenyl)methyl]formamide |
| SMILES | COc1cc(OC)c(CNC=O)cc1F |
| InChI | InChI=1S/C10H12FNO3/c1-14-9-4-10(15-2)8(11)3-7(9)5-12-6-13/h3-4,6H,5H2,1-2H3,(H,12,13) |
| InChIKey | OBDSBGXTSMWBNN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|