C15H24FNO2 — CID 144669442
N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;2-methylpentane (PubChem CID 144669442) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;2-methylpentane.
| Compound Name | N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;2-methylpentane |
|---|---|
| PubChem CID | 144669442 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;2-methylpentane |
| SMILES | CCCC(C)C.COc1cc(CNC=O)ccc1F |
| InChI | InChI=1S/C9H10FNO2.C6H14/c1-13-9-4-7(5-11-6-12)2-3-8(9)10;1-4-5-6(2)3/h2-4,6H,5H2,1H3,(H,11,12);6H,4-5H2,1-3H3 |
| InChIKey | SCQQQOCSXITMCC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|