C15H21FN2O3 — CID 143723971
ethyl 2-[2-fluoro-4-(formamidomethyl)anilino]-3-methylbutanoate (PubChem CID 143723971) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is ethyl 2-[2-fluoro-4-(formamidomethyl)anilino]-3-methylbutanoate.
| Compound Name | ethyl 2-[2-fluoro-4-(formamidomethyl)anilino]-3-methylbutanoate |
|---|---|
| PubChem CID | 143723971 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | ethyl 2-[2-fluoro-4-(formamidomethyl)anilino]-3-methylbutanoate |
| SMILES | CCOC(=O)C(Nc1ccc(CNC=O)cc1F)C(C)C |
| InChI | InChI=1S/C15H21FN2O3/c1-4-21-15(20)14(10(2)3)18-13-6-5-11(7-12(13)16)8-17-9-19/h5-7,9-10,14,18H,4,8H2,1-3H3,(H,17,19) |
| InChIKey | JOKJHKDRCOJJAC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|