C28H40F2N4O4 — CID 144669611
N-(diaminomethylidene)-2-(4-fluoro-3-methoxyphenyl)acetamide;N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;propylcyclohexane (PubChem CID 144669611) has the molecular formula C28H40F2N4O4 and a molecular weight of 534.65 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(4-fluoro-3-methoxyphenyl)acetamide;N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;propylcyclohexane.
| Compound Name | N-(diaminomethylidene)-2-(4-fluoro-3-methoxyphenyl)acetamide;N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;propylcyclohexane |
|---|---|
| PubChem CID | 144669611 |
| Molecular Formula | C28H40F2N4O4 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | N-(diaminomethylidene)-2-(4-fluoro-3-methoxyphenyl)acetamide;N-[(4-fluoro-3-methoxyphenyl)methyl]formamide;propylcyclohexane |
| SMILES | CCCC1CCCCC1.COc1cc(CC(=O)N=C(N)N)ccc1F.COc1cc(CNC=O)ccc1F |
| InChI | InChI=1S/C10H12FN3O2.C9H10FNO2.C9H18/c1-16-8-4-6(2-3-7(8)11)5-9(15)14-10(12)13;1-13-9-4-7(5-11-6-12)2-3-8(9)10;1-2-6-9-7-4-3-5-8-9/h2-4H,5H2,1H3,(H4,12,13,14,15);2-4,6H,5H2,1H3,(H,11,12);9H,2-8H2,1H3 |
| InChIKey | HZGPMVXFXSOVAX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|