C28H37F3N4O5 — CID 144669475
3-cyclohexyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 144669475) has the molecular formula C28H37F3N4O5 and a molecular weight of 566.62 g/mol. Its IUPAC name is 3-cyclohexyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 3-cyclohexyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 144669475 |
| Molecular Formula | C28H37F3N4O5 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 3-cyclohexyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N=C(N)N)cc1OC.O=C(CCC1CCCCC1)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3NO2.C11H15N3O3/c18-17(19,20)23-15-8-4-7-14(11-15)12-21-16(22)10-9-13-5-2-1-3-6-13;1-16-8-4-3-7(5-9(8)17-2)6-10(15)14-11(12)13/h4,7-8,11,13H,1-3,5-6,9-10,12H2,(H,21,22);3-5H,6H2,1-2H3,(H4,12,13,14,15) |
| InChIKey | XDHLKWDOLAZQMH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|