C26H29F7N4O2 — CID 144669466
3-cyclohexyl-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(2,4,6-trifluorophenyl)acetamide (PubChem CID 144669466) has the molecular formula C26H29F7N4O2 and a molecular weight of 562.53 g/mol. Its IUPAC name is 3-cyclohexyl-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(2,4,6-trifluorophenyl)acetamide.
| Compound Name | 3-cyclohexyl-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(2,4,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 144669466 |
| Molecular Formula | C26H29F7N4O2 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 3-cyclohexyl-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]propanamide;N-(diaminomethylidene)-2-(2,4,6-trifluorophenyl)acetamide |
| SMILES | NC(N)=NC(=O)Cc1c(F)cc(F)cc1F.O=C(CCC1CCCCC1)NCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F4NO.C9H8F3N3O/c18-15-8-6-13(10-14(15)17(19,20)21)11-22-16(23)9-7-12-4-2-1-3-5-12;10-4-1-6(11)5(7(12)2-4)3-8(16)15-9(13)14/h6,8,10,12H,1-5,7,9,11H2,(H,22,23);1-2H,3H2,(H4,13,14,15,16) |
| InChIKey | XSWYCIDBFSSYSX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|