C30H43FN4O4 — CID 144669418
3-benzyl-N-(diaminomethylidene)-4-oxobutanamide;3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide;methane (PubChem CID 144669418) has the molecular formula C30H43FN4O4 and a molecular weight of 542.70 g/mol. Its IUPAC name is 3-benzyl-N-(diaminomethylidene)-4-oxobutanamide;3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide;methane.
| Compound Name | 3-benzyl-N-(diaminomethylidene)-4-oxobutanamide;3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide;methane |
|---|---|
| PubChem CID | 144669418 |
| Molecular Formula | C30H43FN4O4 |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 3-benzyl-N-(diaminomethylidene)-4-oxobutanamide;3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide;methane |
| SMILES | C.COc1cc(CNC(=O)CCC2CCCCC2)ccc1F.NC(N)=NC(=O)CC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H24FNO2.C12H15N3O2.CH4/c1-21-16-11-14(7-9-15(16)18)12-19-17(20)10-8-13-5-3-2-4-6-13;13-12(14)15-11(17)7-10(8-16)6-9-4-2-1-3-5-9;/h7,9,11,13H,2-6,8,10,12H2,1H3,(H,19,20);1-5,8,10H,6-7H2,(H4,13,14,15,17);1H4 |
| InChIKey | KLQUXGJXSJYLMA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|