C27H27BrFN3O3 — CID 157370869
(2S)-4-amino-2-benzyl-4-[2-(2-bromophenyl)acetyl]imino-N-[(4-fluoro-3-methoxyphenyl)methyl]butanamide (PubChem CID 157370869) has the molecular formula C27H27BrFN3O3 and a molecular weight of 540.43 g/mol. Its IUPAC name is (2S)-4-amino-2-benzyl-4-[2-(2-bromophenyl)acetyl]imino-N-[(4-fluoro-3-methoxyphenyl)methyl]butanamide.
| Compound Name | (2S)-4-amino-2-benzyl-4-[2-(2-bromophenyl)acetyl]imino-N-[(4-fluoro-3-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 157370869 |
| Molecular Formula | C27H27BrFN3O3 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | (2S)-4-amino-2-benzyl-4-[2-(2-bromophenyl)acetyl]imino-N-[(4-fluoro-3-methoxyphenyl)methyl]butanamide |
| SMILES | COc1cc(CNC(=O)[C@H](C/C(N)=N/C(=O)Cc2ccccc2Br)Cc2ccccc2)ccc1F |
| InChI | InChI=1S/C27H27BrFN3O3/c1-35-24-14-19(11-12-23(24)29)17-31-27(34)21(13-18-7-3-2-4-8-18)15-25(30)32-26(33)16-20-9-5-6-10-22(20)28/h2-12,14,21H,13,15-17H2,1H3,(H,31,34)(H2,30,32,33)/t21-/m0/s1 |
| InChIKey | BJTALBHTWGGXAH-NRFANRHFSA-N |
| XLogP | 4.59 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|