C19H22FNO4 — CID 99817873
(2R)-N-[(3,4-dimethoxyphenyl)methyl]-2-(2-fluorophenoxy)butanamide (PubChem CID 99817873) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is (2R)-N-[(3,4-dimethoxyphenyl)methyl]-2-(2-fluorophenoxy)butanamide.
| Compound Name | (2R)-N-[(3,4-dimethoxyphenyl)methyl]-2-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 99817873 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2R)-N-[(3,4-dimethoxyphenyl)methyl]-2-(2-fluorophenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccccc1F)C(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22FNO4/c1-4-15(25-16-8-6-5-7-14(16)20)19(22)21-12-13-9-10-17(23-2)18(11-13)24-3/h5-11,15H,4,12H2,1-3H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | BQKRCFGJUMDHJB-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |