C19H23NO4 — CID 53286217
2-(2-methoxyphenoxy)-N-[(4-methoxyphenyl)methyl]butanamide (PubChem CID 53286217) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[(4-methoxyphenyl)methyl]butanamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[(4-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 53286217 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[(4-methoxyphenyl)methyl]butanamide |
| SMILES | CCC(Oc1ccccc1OC)C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-4-16(24-18-8-6-5-7-17(18)23-3)19(21)20-13-14-9-11-15(22-2)12-10-14/h5-12,16H,4,13H2,1-3H3,(H,20,21) |
| InChIKey | MTVOTMWJEBFKIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |