C20H25NO5 — CID 38003558
(2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenoxy)butanamide (PubChem CID 38003558) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenoxy)butanamide.
| Compound Name | (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 38003558 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenoxy)butanamide |
| SMILES | CC[C@H](Oc1cccc(OC)c1)C(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25NO5/c1-5-17(26-16-8-6-7-15(12-16)23-2)20(22)21-13-14-9-10-18(24-3)19(11-14)25-4/h6-12,17H,5,13H2,1-4H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | CFSPKKJBGJMUET-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |