C23H30N4O4 — CID 123205154
N-[N'-[1-[(3,4-dimethoxyphenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]carbamimidoyl]-2-methylpropanamide (PubChem CID 123205154) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[N'-[1-[(3,4-dimethoxyphenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]carbamimidoyl]-2-methylpropanamide.
| Compound Name | N-[N'-[1-[(3,4-dimethoxyphenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]carbamimidoyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 123205154 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[N'-[1-[(3,4-dimethoxyphenyl)methylamino]-1-oxo-3-phenylpropan-2-yl]carbamimidoyl]-2-methylpropanamide |
| SMILES | COc1ccc(CNC(=O)C(Cc2ccccc2)/N=C(\N)NC(=O)C(C)C)cc1OC |
| InChI | InChI=1S/C23H30N4O4/c1-15(2)21(28)27-23(24)26-18(12-16-8-6-5-7-9-16)22(29)25-14-17-10-11-19(30-3)20(13-17)31-4/h5-11,13,15,18H,12,14H2,1-4H3,(H,25,29)(H3,24,26,27,28) |
| InChIKey | XBGKXENYYSZVCD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|