C28H29F3N4O5 — CID 175059688
2-[[amino-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 175059688) has the molecular formula C28H29F3N4O5 and a molecular weight of 558.56 g/mol. Its IUPAC name is 2-[[amino-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | 2-[[amino-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 175059688 |
| Molecular Formula | C28H29F3N4O5 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 2-[[amino-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CNC(=O)C(Cc2ccccc2)/N=C(\N)NC(=O)Cc2ccc(OC(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C28H29F3N4O5/c1-38-23-13-10-20(15-24(23)39-2)17-33-26(37)22(14-18-6-4-3-5-7-18)34-27(32)35-25(36)16-19-8-11-21(12-9-19)40-28(29,30)31/h3-13,15,22H,14,16-17H2,1-2H3,(H,33,37)(H3,32,34,35,36) |
| InChIKey | HWEGBEUVHPTKCE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|