C29H37F3N4O6 — CID 175064484
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclohexylmethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 175064484) has the molecular formula C29H37F3N4O6 and a molecular weight of 594.63 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclohexylmethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclohexylmethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175064484 |
| Molecular Formula | C29H37F3N4O6 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(cyclohexylmethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(Cc2ccccc2)C(=O)NCC2CCCCC2)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H36N4O4.C2HF3O2/c1-34-23-14-13-21(16-24(23)35-2)17-25(32)31-27(28)30-22(15-19-9-5-3-6-10-19)26(33)29-18-20-11-7-4-8-12-20;3-2(4,5)1(6)7/h3,5-6,9-10,13-14,16,20,22H,4,7-8,11-12,15,17-18H2,1-2H3,(H,29,33)(H3,28,30,31,32);(H,6,7) |
| InChIKey | VZMPMTDEDKPLLO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 152.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|