C27H42N4O4 — CID 90294435
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(cyclohexylmethyl)propanamide (PubChem CID 90294435) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(cyclohexylmethyl)propanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 90294435 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(cyclohexylmethyl)propanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(CC2CCCCC2)C(=O)NCC2CCCCC2)cc1OC |
| InChI | InChI=1S/C27H42N4O4/c1-34-23-14-13-21(16-24(23)35-2)17-25(32)31-27(28)30-22(15-19-9-5-3-6-10-19)26(33)29-18-20-11-7-4-8-12-20/h13-14,16,19-20,22H,3-12,15,17-18H2,1-2H3,(H,29,33)(H3,28,30,31,32) |
| InChIKey | YRSCCVVTAYDQGJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|