C29H40N4O5 — CID 90285691
(2S)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-(3-methoxyphenyl)ethyl]propanamide (PubChem CID 90285691) has the molecular formula C29H40N4O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is (2S)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-(3-methoxyphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-(3-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 90285691 |
| Molecular Formula | C29H40N4O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | (2S)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-(3-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1cccc([C@H](C)NC(=O)[C@H](CC2CCCCC2)/N=C(\N)NC(=O)Cc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C29H40N4O5/c1-19(22-11-8-12-23(18-22)36-2)31-28(35)24(15-20-9-6-5-7-10-20)32-29(30)33-27(34)17-21-13-14-25(37-3)26(16-21)38-4/h8,11-14,16,18-20,24H,5-7,9-10,15,17H2,1-4H3,(H,31,35)(H3,30,32,33,34)/t19-,24-/m0/s1 |
| InChIKey | AOHCUYQUVZJWHR-CYFREDJKSA-N |
| XLogP | 3.90 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|