C27H37N5O6S — CID 123326688
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide (PubChem CID 123326688) has the molecular formula C27H37N5O6S and a molecular weight of 559.69 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 123326688 |
| Molecular Formula | C27H37N5O6S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(CC2CCCCC2)C(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C27H37N5O6S/c1-37-23-13-10-20(15-24(23)38-2)16-25(33)32-27(28)31-22(14-18-6-4-3-5-7-18)26(34)30-17-19-8-11-21(12-9-19)39(29,35)36/h8-13,15,18,22H,3-7,14,16-17H2,1-2H3,(H,30,34)(H2,29,35,36)(H3,28,31,32,33) |
| InChIKey | MSCSRDACRDKLLI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|