C24H38N4O4 — CID 90294648
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-butan-2-yl-3-cyclohexylpropanamide (PubChem CID 90294648) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-butan-2-yl-3-cyclohexylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-butan-2-yl-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 90294648 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-butan-2-yl-3-cyclohexylpropanamide |
| SMILES | CCC(C)NC(=O)[C@@H](CC1CCCCC1)/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H38N4O4/c1-5-16(2)26-23(30)19(13-17-9-7-6-8-10-17)27-24(25)28-22(29)15-18-11-12-20(31-3)21(14-18)32-4/h11-12,14,16-17,19H,5-10,13,15H2,1-4H3,(H,26,30)(H3,25,27,28,29)/t16?,19-/m1/s1 |
| InChIKey | LBGZWRVTDIMSBD-LRTDYKAYSA-N |
| XLogP | 2.93 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|