C29H38N8O4 — CID 90285754
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-[3-(2H-tetrazol-5-yl)phenyl]ethyl]propanamide (PubChem CID 90285754) has the molecular formula C29H38N8O4 and a molecular weight of 562.68 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-[3-(2H-tetrazol-5-yl)phenyl]ethyl]propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-[3-(2H-tetrazol-5-yl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 90285754 |
| Molecular Formula | C29H38N8O4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(1S)-1-[3-(2H-tetrazol-5-yl)phenyl]ethyl]propanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC2CCCCC2)C(=O)N[C@@H](C)c2cccc(-c3nn[nH]n3)c2)cc1OC |
| InChI | InChI=1S/C29H38N8O4/c1-18(21-10-7-11-22(17-21)27-34-36-37-35-27)31-28(39)23(14-19-8-5-4-6-9-19)32-29(30)33-26(38)16-20-12-13-24(40-2)25(15-20)41-3/h7,10-13,15,17-19,23H,4-6,8-9,14,16H2,1-3H3,(H,31,39)(H3,30,32,33,38)(H,34,35,36,37)/t18-,23+/m0/s1 |
| InChIKey | NMNNSBBRNMIJBZ-FDDCHVKYSA-N |
| XLogP | 3.07 |
| TPSA | 169.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|