C26H34ClN5O4 — CID 123703361
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(6-chloro-3-pyridinyl)methyl]-3-cyclohexylpropanamide (PubChem CID 123703361) has the molecular formula C26H34ClN5O4 and a molecular weight of 516.04 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(6-chloro-3-pyridinyl)methyl]-3-cyclohexylpropanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(6-chloro-3-pyridinyl)methyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 123703361 |
| Molecular Formula | C26H34ClN5O4 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(6-chloro-3-pyridinyl)methyl]-3-cyclohexylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(CC2CCCCC2)C(=O)NCc2ccc(Cl)nc2)cc1OC |
| InChI | InChI=1S/C26H34ClN5O4/c1-35-21-10-8-18(13-22(21)36-2)14-24(33)32-26(28)31-20(12-17-6-4-3-5-7-17)25(34)30-16-19-9-11-23(27)29-15-19/h8-11,13,15,17,20H,3-7,12,14,16H2,1-2H3,(H,30,34)(H3,28,31,32,33) |
| InChIKey | XDGPRNHLEPOWBN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|