C27H32FN5O3 — CID 123816638
2-[[amino-[[2-(3-cyanophenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide (PubChem CID 123816638) has the molecular formula C27H32FN5O3 and a molecular weight of 493.58 g/mol. Its IUPAC name is 2-[[amino-[[2-(3-cyanophenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide.
| Compound Name | 2-[[amino-[[2-(3-cyanophenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 123816638 |
| Molecular Formula | C27H32FN5O3 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-[[amino-[[2-(3-cyanophenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)C(CC2CCCCC2)/N=C(\N)NC(=O)Cc2cccc(C#N)c2)ccc1F |
| InChI | InChI=1S/C27H32FN5O3/c1-36-24-14-21(10-11-22(24)28)17-31-26(35)23(13-18-6-3-2-4-7-18)32-27(30)33-25(34)15-19-8-5-9-20(12-19)16-29/h5,8-12,14,18,23H,2-4,6-7,13,15,17H2,1H3,(H,31,35)(H3,30,32,33,34) |
| InChIKey | MSYAMYUWZJGQHD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|