C27H36FN5O5S — CID 118576378
4-[[[(2R)-2-[[amino-[[2-[3-[methyl(sulfino)amino]phenyl]acetyl]amino]methylidene]amino]-3-cyclohexylpropanoyl]amino]methyl]-1-fluoro-2-methoxybenzene (PubChem CID 118576378) has the molecular formula C27H36FN5O5S and a molecular weight of 561.68 g/mol. Its IUPAC name is 4-[[[(2R)-2-[[amino-[[2-[3-[methyl(sulfino)amino]phenyl]acetyl]amino]methylidene]amino]-3-cyclohexylpropanoyl]amino]methyl]-1-fluoro-2-methoxybenzene.
| Compound Name | 4-[[[(2R)-2-[[amino-[[2-[3-[methyl(sulfino)amino]phenyl]acetyl]amino]methylidene]amino]-3-cyclohexylpropanoyl]amino]methyl]-1-fluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 118576378 |
| Molecular Formula | C27H36FN5O5S |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 4-[[[(2R)-2-[[amino-[[2-[3-[methyl(sulfino)amino]phenyl]acetyl]amino]methylidene]amino]-3-cyclohexylpropanoyl]amino]methyl]-1-fluoro-2-methoxybenzene |
| SMILES | COc1cc(CNC(=O)[C@@H](CC2CCCCC2)/N=C(\N)NC(=O)Cc2cccc(N(C)S(=O)O)c2)ccc1F |
| InChI | InChI=1S/C27H36FN5O5S/c1-33(39(36)37)21-10-6-9-19(13-21)16-25(34)32-27(29)31-23(14-18-7-4-3-5-8-18)26(35)30-17-20-11-12-22(28)24(15-20)38-2/h6,9-13,15,18,23H,3-5,7-8,14,16-17H2,1-2H3,(H,30,35)(H,36,37)(H3,29,31,32,34)/t23-/m1/s1 |
| InChIKey | FGOMLBKNMVPCDF-HSZRJFAPSA-N |
| XLogP | 3.04 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|