C30H39FN4O5 — CID 123719666
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[1-(4-fluoro-3-methoxyphenyl)cyclopropyl]propanamide (PubChem CID 123719666) has the molecular formula C30H39FN4O5 and a molecular weight of 554.66 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[1-(4-fluoro-3-methoxyphenyl)cyclopropyl]propanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[1-(4-fluoro-3-methoxyphenyl)cyclopropyl]propanamide |
|---|---|
| PubChem CID | 123719666 |
| Molecular Formula | C30H39FN4O5 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[1-(4-fluoro-3-methoxyphenyl)cyclopropyl]propanamide |
| SMILES | COc1cc(C2(NC(=O)C(CC3CCCCC3)/N=C(\N)NC(=O)Cc3ccc(OC)c(OC)c3)CC2)ccc1F |
| InChI | InChI=1S/C30H39FN4O5/c1-38-24-12-9-20(16-26(24)40-3)17-27(36)34-29(32)33-23(15-19-7-5-4-6-8-19)28(37)35-30(13-14-30)21-10-11-22(31)25(18-21)39-2/h9-12,16,18-19,23H,4-8,13-15,17H2,1-3H3,(H,35,37)(H3,32,33,34,36) |
| InChIKey | QEGZIOKEMQJBDH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|