C26H34FN5O5S — CID 90285833
(2R)-2-[[amino-[[2-(4-sulfamoylphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide (PubChem CID 90285833) has the molecular formula C26H34FN5O5S and a molecular weight of 547.65 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(4-sulfamoylphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(4-sulfamoylphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 90285833 |
| Molecular Formula | C26H34FN5O5S |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (2R)-2-[[amino-[[2-(4-sulfamoylphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)[C@@H](CC2CCCCC2)/N=C(\N)NC(=O)Cc2ccc(S(N)(=O)=O)cc2)ccc1F |
| InChI | InChI=1S/C26H34FN5O5S/c1-37-23-14-19(9-12-21(23)27)16-30-25(34)22(13-17-5-3-2-4-6-17)31-26(28)32-24(33)15-18-7-10-20(11-8-18)38(29,35)36/h7-12,14,17,22H,2-6,13,15-16H2,1H3,(H,30,34)(H2,29,35,36)(H3,28,31,32,33)/t22-/m1/s1 |
| InChIKey | OLERNBCSIUBSMF-JOCHJYFZSA-N |
| XLogP | 2.11 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|