C29H35F6N5O4 — CID 175059700
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[[3-[bis(trifluoromethyl)amino]phenyl]methyl]-3-cyclohexylpropanamide (PubChem CID 175059700) has the molecular formula C29H35F6N5O4 and a molecular weight of 631.62 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[[3-[bis(trifluoromethyl)amino]phenyl]methyl]-3-cyclohexylpropanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[[3-[bis(trifluoromethyl)amino]phenyl]methyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 175059700 |
| Molecular Formula | C29H35F6N5O4 |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[[3-[bis(trifluoromethyl)amino]phenyl]methyl]-3-cyclohexylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(CC2CCCCC2)C(=O)NCc2cccc(N(C(F)(F)F)C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C29H35F6N5O4/c1-43-23-12-11-19(15-24(23)44-2)16-25(41)39-27(36)38-22(14-18-7-4-3-5-8-18)26(42)37-17-20-9-6-10-21(13-20)40(28(30,31)32)29(33,34)35/h6,9-13,15,18,22H,3-5,7-8,14,16-17H2,1-2H3,(H,37,42)(H3,36,38,39,41) |
| InChIKey | HBPKAAOXQUYLRS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|