C29H37N7O4 — CID 90285381
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propanamide (PubChem CID 90285381) has the molecular formula C29H37N7O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 90285381 |
| Molecular Formula | C29H37N7O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC2CCCCC2)C(=O)NCc2cccc(-n3cncn3)c2)cc1OC |
| InChI | InChI=1S/C29H37N7O4/c1-39-25-12-11-21(15-26(25)40-2)16-27(37)35-29(30)34-24(14-20-7-4-3-5-8-20)28(38)32-17-22-9-6-10-23(13-22)36-19-31-18-33-36/h6,9-13,15,18-20,24H,3-5,7-8,14,16-17H2,1-2H3,(H,32,38)(H3,30,34,35,37)/t24-/m1/s1 |
| InChIKey | KQEFCUAFJGTRSV-XMMPIXPASA-N |
| XLogP | 2.91 |
| TPSA | 145.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|