C26H35N7O5 — CID 175064493
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoic acid;[3-(1,2,4-triazol-1-yl)phenyl]methanamine (PubChem CID 175064493) has the molecular formula C26H35N7O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoic acid;[3-(1,2,4-triazol-1-yl)phenyl]methanamine.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoic acid;[3-(1,2,4-triazol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 175064493 |
| Molecular Formula | C26H35N7O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methylpentanoic acid;[3-(1,2,4-triazol-1-yl)phenyl]methanamine |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(CC(C)C)C(=O)O)cc1OC.NCc1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C17H25N3O5.C9H10N4/c1-10(2)7-12(16(22)23)19-17(18)20-15(21)9-11-5-6-13(24-3)14(8-11)25-4;10-5-8-2-1-3-9(4-8)13-7-11-6-12-13/h5-6,8,10,12H,7,9H2,1-4H3,(H,22,23)(H3,18,19,20,21);1-4,6-7H,5,10H2 |
| InChIKey | LGWCKXXGQBTIOZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 179.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|